C17H16FN3O — CID 97236443
5-fluoro-2-[[(3R)-3-pyridin-4-yloxypyrrolidin-1-yl]methyl]benzonitrile (PubChem CID 97236443) has the molecular formula C17H16FN3O and a molecular weight of 297.33 g/mol. Its IUPAC name is 5-fluoro-2-[[(3R)-3-pyridin-4-yloxypyrrolidin-1-yl]methyl]benzonitrile.
| Compound Name | 5-fluoro-2-[[(3R)-3-pyridin-4-yloxypyrrolidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 97236443 |
| Molecular Formula | C17H16FN3O |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 5-fluoro-2-[[(3R)-3-pyridin-4-yloxypyrrolidin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1cc(F)ccc1CN1CC[C@@H](Oc2ccncc2)C1 |
| InChI | InChI=1S/C17H16FN3O/c18-15-2-1-13(14(9-15)10-19)11-21-8-5-17(12-21)22-16-3-6-20-7-4-16/h1-4,6-7,9,17H,5,8,11-12H2/t17-/m1/s1 |
| InChIKey | AFSOWPPIURTCGE-QGZVFWFLSA-N |
| XLogP | 2.75 |
| TPSA | 49.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |