C18H21FN4 — CID 86771061
5-fluoro-2-[[3-[(1-methylimidazol-2-yl)methyl]piperidin-1-yl]methyl]benzonitrile (PubChem CID 86771061) has the molecular formula C18H21FN4 and a molecular weight of 312.39 g/mol. Its IUPAC name is 5-fluoro-2-[[3-[(1-methylimidazol-2-yl)methyl]piperidin-1-yl]methyl]benzonitrile.
| Compound Name | 5-fluoro-2-[[3-[(1-methylimidazol-2-yl)methyl]piperidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 86771061 |
| Molecular Formula | C18H21FN4 |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 5-fluoro-2-[[3-[(1-methylimidazol-2-yl)methyl]piperidin-1-yl]methyl]benzonitrile |
| SMILES | Cn1ccnc1CC1CCCN(Cc2ccc(F)cc2C#N)C1 |
| InChI | InChI=1S/C18H21FN4/c1-22-8-6-21-18(22)9-14-3-2-7-23(12-14)13-15-4-5-17(19)10-16(15)11-20/h4-6,8,10,14H,2-3,7,9,12-13H2,1H3 |
| InChIKey | LRIICVMZGFRQKH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 44.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |