C14H18FN3O2S — CID 86770943
[1-[(2-cyano-5-fluorophenyl)methyl]piperidin-3-yl]methanesulfonamide (PubChem CID 86770943) has the molecular formula C14H18FN3O2S and a molecular weight of 311.38 g/mol. Its IUPAC name is [1-[(2-cyano-5-fluorophenyl)methyl]piperidin-3-yl]methanesulfonamide.
| Compound Name | [1-[(2-cyano-5-fluorophenyl)methyl]piperidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 86770943 |
| Molecular Formula | C14H18FN3O2S |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | [1-[(2-cyano-5-fluorophenyl)methyl]piperidin-3-yl]methanesulfonamide |
| SMILES | N#Cc1ccc(F)cc1CN1CCCC(CS(N)(=O)=O)C1 |
| InChI | InChI=1S/C14H18FN3O2S/c15-14-4-3-12(7-16)13(6-14)9-18-5-1-2-11(8-18)10-21(17,19)20/h3-4,6,11H,1-2,5,8-10H2,(H2,17,19,20) |
| InChIKey | GIHZSQNOHCHENY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |