C18H29N5 — CID 86791637
1-[(5-tert-butyl-1H-pyrazol-4-yl)methyl]-3-[(1-methylimidazol-2-yl)methyl]piperidine (PubChem CID 86791637) has the molecular formula C18H29N5 and a molecular weight of 315.47 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1H-pyrazol-4-yl)methyl]-3-[(1-methylimidazol-2-yl)methyl]piperidine.
| Compound Name | 1-[(5-tert-butyl-1H-pyrazol-4-yl)methyl]-3-[(1-methylimidazol-2-yl)methyl]piperidine |
|---|---|
| PubChem CID | 86791637 |
| Molecular Formula | C18H29N5 |
| Molecular Weight | 315.47 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | 1-[(5-tert-butyl-1H-pyrazol-4-yl)methyl]-3-[(1-methylimidazol-2-yl)methyl]piperidine |
| SMILES | Cn1ccnc1CC1CCCN(Cc2cn[nH]c2C(C)(C)C)C1 |
| InChI | InChI=1S/C18H29N5/c1-18(2,3)17-15(11-20-21-17)13-23-8-5-6-14(12-23)10-16-19-7-9-22(16)4/h7,9,11,14H,5-6,8,10,12-13H2,1-4H3,(H,20,21) |
| InChIKey | GCPWZEYXIGXCKL-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |