C17H22N4O3S — CID 166296334
[2-(1,3-dimethylpyrazol-4-yl)pyrrolidin-1-yl]-(2,2-dioxo-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]thiazin-8-yl)methanone (PubChem CID 166296334) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is [2-(1,3-dimethylpyrazol-4-yl)pyrrolidin-1-yl]-(2,2-dioxo-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]thiazin-8-yl)methanone.
| Compound Name | [2-(1,3-dimethylpyrazol-4-yl)pyrrolidin-1-yl]-(2,2-dioxo-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]thiazin-8-yl)methanone |
|---|---|
| PubChem CID | 166296334 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | [2-(1,3-dimethylpyrazol-4-yl)pyrrolidin-1-yl]-(2,2-dioxo-3,4-dihydro-1H-pyrrolo[2,1-c][1,4]thiazin-8-yl)methanone |
| SMILES | Cc1nn(C)cc1C1CCCN1C(=O)c1ccn2c1CS(=O)(=O)CC2 |
| InChI | InChI=1S/C17H22N4O3S/c1-12-14(10-19(2)18-12)15-4-3-6-21(15)17(22)13-5-7-20-8-9-25(23,24)11-16(13)20/h5,7,10,15H,3-4,6,8-9,11H2,1-2H3 |
| InChIKey | BVRHHEYMMBUUJZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 77.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |