C19H25NO5 — CID 166296448
methyl 2-[6-[(2R)-2-(4-hydroxyphenoxy)propanoyl]-6-azaspiro[3.4]octan-7-yl]acetate (PubChem CID 166296448) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is methyl 2-[6-[(2R)-2-(4-hydroxyphenoxy)propanoyl]-6-azaspiro[3.4]octan-7-yl]acetate.
| Compound Name | methyl 2-[6-[(2R)-2-(4-hydroxyphenoxy)propanoyl]-6-azaspiro[3.4]octan-7-yl]acetate |
|---|---|
| PubChem CID | 166296448 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | methyl 2-[6-[(2R)-2-(4-hydroxyphenoxy)propanoyl]-6-azaspiro[3.4]octan-7-yl]acetate |
| SMILES | COC(=O)CC1CC2(CCC2)CN1C(=O)[C@@H](C)Oc1ccc(O)cc1 |
| InChI | InChI=1S/C19H25NO5/c1-13(25-16-6-4-15(21)5-7-16)18(23)20-12-19(8-3-9-19)11-14(20)10-17(22)24-2/h4-7,13-14,21H,3,8-12H2,1-2H3/t13-,14?/m1/s1 |
| InChIKey | QVWVFHBLPHUBNB-KWCCSABGSA-N |
| XLogP | 2.49 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |