C18H23F3N4O3 — CID 166299142
5-amino-N-[4-(4,5-dimethylimidazol-1-yl)phenyl]pentanamide;2,2,2-trifluoroacetic acid (PubChem CID 166299142) has the molecular formula C18H23F3N4O3 and a molecular weight of 400.40 g/mol. Its IUPAC name is 5-amino-N-[4-(4,5-dimethylimidazol-1-yl)phenyl]pentanamide;2,2,2-trifluoroacetic acid.
| Compound Name | 5-amino-N-[4-(4,5-dimethylimidazol-1-yl)phenyl]pentanamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 166299142 |
| Molecular Formula | C18H23F3N4O3 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 5-amino-N-[4-(4,5-dimethylimidazol-1-yl)phenyl]pentanamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ncn(-c2ccc(NC(=O)CCCCN)cc2)c1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H22N4O.C2HF3O2/c1-12-13(2)20(11-18-12)15-8-6-14(7-9-15)19-16(21)5-3-4-10-17;3-2(4,5)1(6)7/h6-9,11H,3-5,10,17H2,1-2H3,(H,19,21);(H,6,7) |
| InChIKey | STMPMQRCOFTTEU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|