C19H25N5O2 — CID 166299167
1-(2-aminoethyl)-N-[4-(4,5-dimethylimidazol-1-yl)phenyl]-2-oxopiperidine-3-carboxamide (PubChem CID 166299167) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-[4-(4,5-dimethylimidazol-1-yl)phenyl]-2-oxopiperidine-3-carboxamide.
| Compound Name | 1-(2-aminoethyl)-N-[4-(4,5-dimethylimidazol-1-yl)phenyl]-2-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 166299167 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 1-(2-aminoethyl)-N-[4-(4,5-dimethylimidazol-1-yl)phenyl]-2-oxopiperidine-3-carboxamide |
| SMILES | Cc1ncn(-c2ccc(NC(=O)C3CCCN(CCN)C3=O)cc2)c1C |
| InChI | InChI=1S/C19H25N5O2/c1-13-14(2)24(12-21-13)16-7-5-15(6-8-16)22-18(25)17-4-3-10-23(11-9-20)19(17)26/h5-8,12,17H,3-4,9-11,20H2,1-2H3,(H,22,25) |
| InChIKey | NXEVDJQKLGMJIC-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|