C21H25N5O3 — CID 166285379
N-[4-(4,5-dimethylimidazol-1-yl)phenyl]-3-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxamide (PubChem CID 166285379) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-[4-(4,5-dimethylimidazol-1-yl)phenyl]-3-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxamide.
| Compound Name | N-[4-(4,5-dimethylimidazol-1-yl)phenyl]-3-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxamide |
|---|---|
| PubChem CID | 166285379 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | N-[4-(4,5-dimethylimidazol-1-yl)phenyl]-3-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decane-8-carboxamide |
| SMILES | Cc1ncn(-c2ccc(NC(=O)C3CCC4(CC3)NC(=O)N(C)C4=O)cc2)c1C |
| InChI | InChI=1S/C21H25N5O3/c1-13-14(2)26(12-22-13)17-6-4-16(5-7-17)23-18(27)15-8-10-21(11-9-15)19(28)25(3)20(29)24-21/h4-7,12,15H,8-11H2,1-3H3,(H,23,27)(H,24,29) |
| InChIKey | CSWAKFDJJKTRRE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|