C16H12BrN3O3S3 — CID 16630018
3-[(5Z)-5-[(5-bromo-2-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)propanamide (PubChem CID 16630018) has the molecular formula C16H12BrN3O3S3 and a molecular weight of 470.40 g/mol. Its IUPAC name is 3-[(5Z)-5-[(5-bromo-2-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-[(5Z)-5-[(5-bromo-2-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 16630018 |
| Molecular Formula | C16H12BrN3O3S3 |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 468.92 |
| IUPAC Name | 3-[(5Z)-5-[(5-bromo-2-hydroxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)propanamide |
| SMILES | O=C(CCN1C(=O)/C(=C/c2cc(Br)ccc2O)SC1=S)Nc1nccs1 |
| InChI | InChI=1S/C16H12BrN3O3S3/c17-10-1-2-11(21)9(7-10)8-12-14(23)20(16(24)26-12)5-3-13(22)19-15-18-4-6-25-15/h1-2,4,6-8,21H,3,5H2,(H,18,19,22)/b12-8- |
| InChIKey | DGTARWWLCCHVAG-WQLSENKSSA-N |
| XLogP | 3.84 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|