C18H26ClNO4 — CID 166300855
2-[[2-(4-chlorophenyl)-4-methylpentanoyl]amino]-4-hydroxy-4-methylpentanoic acid (PubChem CID 166300855) has the molecular formula C18H26ClNO4 and a molecular weight of 355.86 g/mol. Its IUPAC name is 2-[[2-(4-chlorophenyl)-4-methylpentanoyl]amino]-4-hydroxy-4-methylpentanoic acid.
| Compound Name | 2-[[2-(4-chlorophenyl)-4-methylpentanoyl]amino]-4-hydroxy-4-methylpentanoic acid |
|---|---|
| PubChem CID | 166300855 |
| Molecular Formula | C18H26ClNO4 |
| Molecular Weight | 355.86 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | 2-[[2-(4-chlorophenyl)-4-methylpentanoyl]amino]-4-hydroxy-4-methylpentanoic acid |
| SMILES | CC(C)CC(C(=O)NC(CC(C)(C)O)C(=O)O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H26ClNO4/c1-11(2)9-14(12-5-7-13(19)8-6-12)16(21)20-15(17(22)23)10-18(3,4)24/h5-8,11,14-15,24H,9-10H2,1-4H3,(H,20,21)(H,22,23) |
| InChIKey | RJXCMHAQIKRMDH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.86 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |