C12H14F2N2O — CID 166301389
2-amino-4,6-difluoro-N-[(E)-pent-2-enyl]benzamide (PubChem CID 166301389) has the molecular formula C12H14F2N2O and a molecular weight of 240.25 g/mol. Its IUPAC name is 2-amino-4,6-difluoro-N-[(E)-pent-2-enyl]benzamide.
| Compound Name | 2-amino-4,6-difluoro-N-[(E)-pent-2-enyl]benzamide |
|---|---|
| PubChem CID | 166301389 |
| Molecular Formula | C12H14F2N2O |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 2-amino-4,6-difluoro-N-[(E)-pent-2-enyl]benzamide |
| SMILES | CC/C=C/CNC(=O)c1c(N)cc(F)cc1F |
| InChI | InChI=1S/C12H14F2N2O/c1-2-3-4-5-16-12(17)11-9(14)6-8(13)7-10(11)15/h3-4,6-7H,2,5,15H2,1H3,(H,16,17)/b4-3+ |
| InChIKey | MMEMYWCJDJTFAW-ONEGZZNKSA-N |
| XLogP | 2.24 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|