C14H21N3OS — CID 166301885
2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-[2-(5-methyl-1,3-thiazol-2-yl)propan-2-yl]acetamide (PubChem CID 166301885) has the molecular formula C14H21N3OS and a molecular weight of 279.41 g/mol. Its IUPAC name is 2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-[2-(5-methyl-1,3-thiazol-2-yl)propan-2-yl]acetamide.
| Compound Name | 2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-[2-(5-methyl-1,3-thiazol-2-yl)propan-2-yl]acetamide |
|---|---|
| PubChem CID | 166301885 |
| Molecular Formula | C14H21N3OS |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-[2-(5-methyl-1,3-thiazol-2-yl)propan-2-yl]acetamide |
| SMILES | Cc1cnc(C(C)(C)NC(=O)C[C@H]2C=C[C@@H](N)C2)s1 |
| InChI | InChI=1S/C14H21N3OS/c1-9-8-16-13(19-9)14(2,3)17-12(18)7-10-4-5-11(15)6-10/h4-5,8,10-11H,6-7,15H2,1-3H3,(H,17,18)/t10-,11+/m0/s1 |
| InChIKey | FBWLCXKLFQQWMP-WDEREUQCSA-N |
| XLogP | 2.10 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|