C15H15F3N4O — CID 166302719
N-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]acetamide (PubChem CID 166302719) has the molecular formula C15H15F3N4O and a molecular weight of 324.31 g/mol. Its IUPAC name is N-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]acetamide.
| Compound Name | N-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]acetamide |
|---|---|
| PubChem CID | 166302719 |
| Molecular Formula | C15H15F3N4O |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | N-(5,6,7,8-tetrahydronaphthalen-1-yl)-2-[3-(trifluoromethyl)-1,2,4-triazol-1-yl]acetamide |
| SMILES | O=C(Cn1cnc(C(F)(F)F)n1)Nc1cccc2c1CCCC2 |
| InChI | InChI=1S/C15H15F3N4O/c16-15(17,18)14-19-9-22(21-14)8-13(23)20-12-7-3-5-10-4-1-2-6-11(10)12/h3,5,7,9H,1-2,4,6,8H2,(H,20,23) |
| InChIKey | QSQJNGRTZFIRTJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |