C15H16F2N4O2 — CID 166303044
1-[3-(2,2-difluoroethyl)phenyl]-3-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)urea (PubChem CID 166303044) has the molecular formula C15H16F2N4O2 and a molecular weight of 322.31 g/mol. Its IUPAC name is 1-[3-(2,2-difluoroethyl)phenyl]-3-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)urea.
| Compound Name | 1-[3-(2,2-difluoroethyl)phenyl]-3-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)urea |
|---|---|
| PubChem CID | 166303044 |
| Molecular Formula | C15H16F2N4O2 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 1-[3-(2,2-difluoroethyl)phenyl]-3-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)urea |
| SMILES | O=C(Nc1cccc(CC(F)F)c1)Nc1n[nH]c2c1COCC2 |
| InChI | InChI=1S/C15H16F2N4O2/c16-13(17)7-9-2-1-3-10(6-9)18-15(22)19-14-11-8-23-5-4-12(11)20-21-14/h1-3,6,13H,4-5,7-8H2,(H3,18,19,20,21,22) |
| InChIKey | JEMLKMDIRFDZTO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |