C16H18FN3O3 — CID 167756632
2-[2-(3-fluorophenyl)ethoxy]-N-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)acetamide (PubChem CID 167756632) has the molecular formula C16H18FN3O3 and a molecular weight of 319.34 g/mol. Its IUPAC name is 2-[2-(3-fluorophenyl)ethoxy]-N-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)acetamide.
| Compound Name | 2-[2-(3-fluorophenyl)ethoxy]-N-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)acetamide |
|---|---|
| PubChem CID | 167756632 |
| Molecular Formula | C16H18FN3O3 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 2-[2-(3-fluorophenyl)ethoxy]-N-(1,4,6,7-tetrahydropyrano[4,3-c]pyrazol-3-yl)acetamide |
| SMILES | O=C(COCCc1cccc(F)c1)Nc1n[nH]c2c1COCC2 |
| InChI | InChI=1S/C16H18FN3O3/c17-12-3-1-2-11(8-12)4-6-23-10-15(21)18-16-13-9-22-7-5-14(13)19-20-16/h1-3,8H,4-7,9-10H2,(H2,18,19,20,21) |
| InChIKey | JYZWRLLHOGYWBY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|