C23H22FNO4 — CID 55761188
N-[3-[(3-fluorophenoxy)methyl]phenyl]-2-(2-phenoxyethoxy)acetamide (PubChem CID 55761188) has the molecular formula C23H22FNO4 and a molecular weight of 395.43 g/mol. Its IUPAC name is N-[3-[(3-fluorophenoxy)methyl]phenyl]-2-(2-phenoxyethoxy)acetamide.
| Compound Name | N-[3-[(3-fluorophenoxy)methyl]phenyl]-2-(2-phenoxyethoxy)acetamide |
|---|---|
| PubChem CID | 55761188 |
| Molecular Formula | C23H22FNO4 |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N-[3-[(3-fluorophenoxy)methyl]phenyl]-2-(2-phenoxyethoxy)acetamide |
| SMILES | O=C(COCCOc1ccccc1)Nc1cccc(COc2cccc(F)c2)c1 |
| InChI | InChI=1S/C23H22FNO4/c24-19-7-5-11-22(15-19)29-16-18-6-4-8-20(14-18)25-23(26)17-27-12-13-28-21-9-2-1-3-10-21/h1-11,14-15H,12-13,16-17H2,(H,25,26) |
| InChIKey | BEEUHOLGZOSWKF-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|