C19H24N2O3 — CID 166303347
1-(2,3-dihydro-1H-indene-5-carbonyl)-4-hydroxy-N-(2-methylprop-2-enyl)pyrrolidine-2-carboxamide (PubChem CID 166303347) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-indene-5-carbonyl)-4-hydroxy-N-(2-methylprop-2-enyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(2,3-dihydro-1H-indene-5-carbonyl)-4-hydroxy-N-(2-methylprop-2-enyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166303347 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 1-(2,3-dihydro-1H-indene-5-carbonyl)-4-hydroxy-N-(2-methylprop-2-enyl)pyrrolidine-2-carboxamide |
| SMILES | C=C(C)CNC(=O)C1CC(O)CN1C(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C19H24N2O3/c1-12(2)10-20-18(23)17-9-16(22)11-21(17)19(24)15-7-6-13-4-3-5-14(13)8-15/h6-8,16-17,22H,1,3-5,9-11H2,2H3,(H,20,23) |
| InChIKey | DSDHUMXATVCVIP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|