C15H20O4 — CID 166304036
2-[4-[2-(2-prop-2-ynoxyethoxy)ethoxy]phenyl]ethanol (PubChem CID 166304036) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 2-[4-[2-(2-prop-2-ynoxyethoxy)ethoxy]phenyl]ethanol.
| Compound Name | 2-[4-[2-(2-prop-2-ynoxyethoxy)ethoxy]phenyl]ethanol |
|---|---|
| PubChem CID | 166304036 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-[4-[2-(2-prop-2-ynoxyethoxy)ethoxy]phenyl]ethanol |
| SMILES | C#CCOCCOCCOc1ccc(CCO)cc1 |
| InChI | InChI=1S/C15H20O4/c1-2-9-17-10-11-18-12-13-19-15-5-3-14(4-6-15)7-8-16/h1,3-6,16H,7-13H2 |
| InChIKey | CKDZMBCWMCSZNL-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|