C28H42O10 — CID 53342216
1,4-bis[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]benzene (PubChem CID 53342216) has the molecular formula C28H42O10 and a molecular weight of 538.63 g/mol. Its IUPAC name is 1,4-bis[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]benzene.
| Compound Name | 1,4-bis[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]benzene |
|---|---|
| PubChem CID | 53342216 |
| Molecular Formula | C28H42O10 |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | 1,4-bis[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethoxy]benzene |
| SMILES | C#CCOCCOCCOCCOCCOc1ccc(OCCOCCOCCOCCOCC#C)cc1 |
| InChI | InChI=1S/C28H42O10/c1-3-9-29-11-13-31-15-17-33-19-21-35-23-25-37-27-5-7-28(8-6-27)38-26-24-36-22-20-34-18-16-32-14-12-30-10-4-2/h1-2,5-8H,9-26H2 |
| InChIKey | SUMFUOQNXLIPLT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|