C23H28N2O4 — CID 166304324
methyl 2-[[4-[1-(aminomethyl)cyclopropyl]benzoyl]amino]-4-(4-methoxyphenyl)butanoate (PubChem CID 166304324) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is methyl 2-[[4-[1-(aminomethyl)cyclopropyl]benzoyl]amino]-4-(4-methoxyphenyl)butanoate.
| Compound Name | methyl 2-[[4-[1-(aminomethyl)cyclopropyl]benzoyl]amino]-4-(4-methoxyphenyl)butanoate |
|---|---|
| PubChem CID | 166304324 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | methyl 2-[[4-[1-(aminomethyl)cyclopropyl]benzoyl]amino]-4-(4-methoxyphenyl)butanoate |
| SMILES | COC(=O)C(CCc1ccc(OC)cc1)NC(=O)c1ccc(C2(CN)CC2)cc1 |
| InChI | InChI=1S/C23H28N2O4/c1-28-19-10-3-16(4-11-19)5-12-20(22(27)29-2)25-21(26)17-6-8-18(9-7-17)23(15-24)13-14-23/h3-4,6-11,20H,5,12-15,24H2,1-2H3,(H,25,26) |
| InChIKey | GDJLJTJLAVOGNE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |