C26H28N2O4 — CID 123668434
2-[[4-amino-3-[2-(4-methoxyphenyl)ethyl]benzoyl]amino]-4-phenylbutanoic acid (PubChem CID 123668434) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is 2-[[4-amino-3-[2-(4-methoxyphenyl)ethyl]benzoyl]amino]-4-phenylbutanoic acid.
| Compound Name | 2-[[4-amino-3-[2-(4-methoxyphenyl)ethyl]benzoyl]amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 123668434 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 2-[[4-amino-3-[2-(4-methoxyphenyl)ethyl]benzoyl]amino]-4-phenylbutanoic acid |
| SMILES | COc1ccc(CCc2cc(C(=O)NC(CCc3ccccc3)C(=O)O)ccc2N)cc1 |
| InChI | InChI=1S/C26H28N2O4/c1-32-22-13-8-19(9-14-22)7-11-20-17-21(12-15-23(20)27)25(29)28-24(26(30)31)16-10-18-5-3-2-4-6-18/h2-6,8-9,12-15,17,24H,7,10-11,16,27H2,1H3,(H,28,29)(H,30,31) |
| InChIKey | DSACJTUESQLUHP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|