C34H35N3O5 — CID 123250710
2-[[4-[(2-amino-3-phenylpropanoyl)amino]-3-[2-(4-hydroxyphenyl)ethyl]benzoyl]amino]-4-phenylbutanoic acid (PubChem CID 123250710) has the molecular formula C34H35N3O5 and a molecular weight of 565.67 g/mol. Its IUPAC name is 2-[[4-[(2-amino-3-phenylpropanoyl)amino]-3-[2-(4-hydroxyphenyl)ethyl]benzoyl]amino]-4-phenylbutanoic acid.
| Compound Name | 2-[[4-[(2-amino-3-phenylpropanoyl)amino]-3-[2-(4-hydroxyphenyl)ethyl]benzoyl]amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 123250710 |
| Molecular Formula | C34H35N3O5 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.26 |
| IUPAC Name | 2-[[4-[(2-amino-3-phenylpropanoyl)amino]-3-[2-(4-hydroxyphenyl)ethyl]benzoyl]amino]-4-phenylbutanoic acid |
| SMILES | NC(Cc1ccccc1)C(=O)Nc1ccc(C(=O)NC(CCc2ccccc2)C(=O)O)cc1CCc1ccc(O)cc1 |
| InChI | InChI=1S/C34H35N3O5/c35-29(21-25-9-5-2-6-10-25)33(40)36-30-20-16-27(22-26(30)15-11-24-12-17-28(38)18-13-24)32(39)37-31(34(41)42)19-14-23-7-3-1-4-8-23/h1-10,12-13,16-18,20,22,29,31,38H,11,14-15,19,21,35H2,(H,36,40)(H,37,39)(H,41,42) |
| InChIKey | JVXJXYKOYQTRAZ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |