C28H32N2O4 — CID 123967817
propan-2-yl 2-[[4-amino-3-[2-(4-hydroxyphenyl)ethyl]benzoyl]amino]-4-phenylbutanoate (PubChem CID 123967817) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is propan-2-yl 2-[[4-amino-3-[2-(4-hydroxyphenyl)ethyl]benzoyl]amino]-4-phenylbutanoate.
| Compound Name | propan-2-yl 2-[[4-amino-3-[2-(4-hydroxyphenyl)ethyl]benzoyl]amino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 123967817 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | propan-2-yl 2-[[4-amino-3-[2-(4-hydroxyphenyl)ethyl]benzoyl]amino]-4-phenylbutanoate |
| SMILES | CC(C)OC(=O)C(CCc1ccccc1)NC(=O)c1ccc(N)c(CCc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C28H32N2O4/c1-19(2)34-28(33)26(17-11-20-6-4-3-5-7-20)30-27(32)23-13-16-25(29)22(18-23)12-8-21-9-14-24(31)15-10-21/h3-7,9-10,13-16,18-19,26,31H,8,11-12,17,29H2,1-2H3,(H,30,32) |
| InChIKey | NEHOCZPCKSARQT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|