C30H32N2O6 — CID 162024782
tert-butyl (2S)-2-[[3-[3-(4-hydroxyphenyl)prop-1-enyl]-4-nitrobenzoyl]amino]-4-phenylbutanoate (PubChem CID 162024782) has the molecular formula C30H32N2O6 and a molecular weight of 516.59 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[3-[3-(4-hydroxyphenyl)prop-1-enyl]-4-nitrobenzoyl]amino]-4-phenylbutanoate.
| Compound Name | tert-butyl (2S)-2-[[3-[3-(4-hydroxyphenyl)prop-1-enyl]-4-nitrobenzoyl]amino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 162024782 |
| Molecular Formula | C30H32N2O6 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | tert-butyl (2S)-2-[[3-[3-(4-hydroxyphenyl)prop-1-enyl]-4-nitrobenzoyl]amino]-4-phenylbutanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CCc1ccccc1)NC(=O)c1ccc([N+](=O)[O-])c(C=CCc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C30H32N2O6/c1-30(2,3)38-29(35)26(18-14-21-8-5-4-6-9-21)31-28(34)24-15-19-27(32(36)37)23(20-24)11-7-10-22-12-16-25(33)17-13-22/h4-9,11-13,15-17,19-20,26,33H,10,14,18H2,1-3H3,(H,31,34)/t26-/m0/s1 |
| InChIKey | YVFOKCCWHAWHEI-SANMLTNESA-N |
| XLogP | 5.63 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|