C29H32N2O7 — CID 90371445
tert-butyl (2S)-2-[[3-[2-(4-hydroxyphenyl)ethoxy]-4-nitrobenzoyl]amino]-4-phenylbutanoate (PubChem CID 90371445) has the molecular formula C29H32N2O7 and a molecular weight of 520.58 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[3-[2-(4-hydroxyphenyl)ethoxy]-4-nitrobenzoyl]amino]-4-phenylbutanoate.
| Compound Name | tert-butyl (2S)-2-[[3-[2-(4-hydroxyphenyl)ethoxy]-4-nitrobenzoyl]amino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 90371445 |
| Molecular Formula | C29H32N2O7 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | tert-butyl (2S)-2-[[3-[2-(4-hydroxyphenyl)ethoxy]-4-nitrobenzoyl]amino]-4-phenylbutanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CCc1ccccc1)NC(=O)c1ccc([N+](=O)[O-])c(OCCc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C29H32N2O7/c1-29(2,3)38-28(34)24(15-11-20-7-5-4-6-8-20)30-27(33)22-12-16-25(31(35)36)26(19-22)37-18-17-21-9-13-23(32)14-10-21/h4-10,12-14,16,19,24,32H,11,15,17-18H2,1-3H3,(H,30,33)/t24-/m0/s1 |
| InChIKey | VILUOIFKDXYXKG-DEOSSOPVSA-N |
| XLogP | 4.99 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|