C28H30N2O7 — CID 90371419
tert-butyl (2S)-2-[[3-[(4-hydroxyphenoxy)methyl]-4-nitrobenzoyl]amino]-4-phenylbutanoate (PubChem CID 90371419) has the molecular formula C28H30N2O7 and a molecular weight of 506.56 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[3-[(4-hydroxyphenoxy)methyl]-4-nitrobenzoyl]amino]-4-phenylbutanoate.
| Compound Name | tert-butyl (2S)-2-[[3-[(4-hydroxyphenoxy)methyl]-4-nitrobenzoyl]amino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 90371419 |
| Molecular Formula | C28H30N2O7 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | tert-butyl (2S)-2-[[3-[(4-hydroxyphenoxy)methyl]-4-nitrobenzoyl]amino]-4-phenylbutanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CCc1ccccc1)NC(=O)c1ccc([N+](=O)[O-])c(COc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C28H30N2O7/c1-28(2,3)37-27(33)24(15-9-19-7-5-4-6-8-19)29-26(32)20-10-16-25(30(34)35)21(17-20)18-36-23-13-11-22(31)12-14-23/h4-8,10-14,16-17,24,31H,9,15,18H2,1-3H3,(H,29,32)/t24-/m0/s1 |
| InChIKey | BNAJQYRDZDPSTQ-DEOSSOPVSA-N |
| XLogP | 4.95 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|