C25H20N2O5 — CID 144689759
(2S)-2-[[4-nitro-3-(2-phenylethynyl)benzoyl]amino]-4-phenylbutanoic acid (PubChem CID 144689759) has the molecular formula C25H20N2O5 and a molecular weight of 428.44 g/mol. Its IUPAC name is (2S)-2-[[4-nitro-3-(2-phenylethynyl)benzoyl]amino]-4-phenylbutanoic acid.
| Compound Name | (2S)-2-[[4-nitro-3-(2-phenylethynyl)benzoyl]amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 144689759 |
| Molecular Formula | C25H20N2O5 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | (2S)-2-[[4-nitro-3-(2-phenylethynyl)benzoyl]amino]-4-phenylbutanoic acid |
| SMILES | O=C(N[C@@H](CCc1ccccc1)C(=O)O)c1ccc([N+](=O)[O-])c(C#Cc2ccccc2)c1 |
| InChI | InChI=1S/C25H20N2O5/c28-24(26-22(25(29)30)15-12-19-9-5-2-6-10-19)21-14-16-23(27(31)32)20(17-21)13-11-18-7-3-1-4-8-18/h1-10,14,16-17,22H,12,15H2,(H,26,28)(H,29,30)/t22-/m0/s1 |
| InChIKey | JSSJOFJHGLQBQU-QFIPXVFZSA-N |
| XLogP | 3.81 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|