C28H32N2O5 — CID 90371448
tert-butyl (2S)-2-[[4-amino-3-[(4-hydroxyphenoxy)methyl]benzoyl]amino]-4-phenylbutanoate (PubChem CID 90371448) has the molecular formula C28H32N2O5 and a molecular weight of 476.57 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[4-amino-3-[(4-hydroxyphenoxy)methyl]benzoyl]amino]-4-phenylbutanoate.
| Compound Name | tert-butyl (2S)-2-[[4-amino-3-[(4-hydroxyphenoxy)methyl]benzoyl]amino]-4-phenylbutanoate |
|---|---|
| PubChem CID | 90371448 |
| Molecular Formula | C28H32N2O5 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | tert-butyl (2S)-2-[[4-amino-3-[(4-hydroxyphenoxy)methyl]benzoyl]amino]-4-phenylbutanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CCc1ccccc1)NC(=O)c1ccc(N)c(COc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C28H32N2O5/c1-28(2,3)35-27(33)25(16-9-19-7-5-4-6-8-19)30-26(32)20-10-15-24(29)21(17-20)18-34-23-13-11-22(31)12-14-23/h4-8,10-15,17,25,31H,9,16,18,29H2,1-3H3,(H,30,32)/t25-/m0/s1 |
| InChIKey | JKHZORJVGAWVMY-VWLOTQADSA-N |
| XLogP | 4.63 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|