C37H35N3O6 — CID 70688000
(2S)-2-[[4-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-(naphthalen-2-ylmethoxy)benzoyl]amino]-4-phenylbutanoic acid (PubChem CID 70688000) has the molecular formula C37H35N3O6 and a molecular weight of 617.70 g/mol. Its IUPAC name is (2S)-2-[[4-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-(naphthalen-2-ylmethoxy)benzoyl]amino]-4-phenylbutanoic acid.
| Compound Name | (2S)-2-[[4-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-(naphthalen-2-ylmethoxy)benzoyl]amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 70688000 |
| Molecular Formula | C37H35N3O6 |
| Molecular Weight | 617.70 g/mol |
| Exact Mass | 617.25 |
| IUPAC Name | (2S)-2-[[4-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-3-(naphthalen-2-ylmethoxy)benzoyl]amino]-4-phenylbutanoic acid |
| SMILES | N[C@@H](Cc1ccc(O)cc1)C(=O)Nc1ccc(C(=O)N[C@@H](CCc2ccccc2)C(=O)O)cc1OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C37H35N3O6/c38-31(21-25-11-16-30(41)17-12-25)36(43)39-32-19-15-29(35(42)40-33(37(44)45)18-13-24-6-2-1-3-7-24)22-34(32)46-23-26-10-14-27-8-4-5-9-28(27)20-26/h1-12,14-17,19-20,22,31,33,41H,13,18,21,23,38H2,(H,39,43)(H,40,42)(H,44,45)/t31-,33-/m0/s1 |
| InChIKey | FPMOHQKBQJPYJS-WEZIJMHWSA-N |
| XLogP | 5.45 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.70 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |