C29H33N3O5 — CID 56659990
(2S)-2-[[4-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-phenylmethoxybenzoyl]amino]-4-phenylbutanoic acid (PubChem CID 56659990) has the molecular formula C29H33N3O5 and a molecular weight of 503.60 g/mol. Its IUPAC name is (2S)-2-[[4-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-phenylmethoxybenzoyl]amino]-4-phenylbutanoic acid.
| Compound Name | (2S)-2-[[4-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-phenylmethoxybenzoyl]amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 56659990 |
| Molecular Formula | C29H33N3O5 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | (2S)-2-[[4-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-phenylmethoxybenzoyl]amino]-4-phenylbutanoic acid |
| SMILES | CC(C)[C@H](N)C(=O)Nc1ccc(C(=O)N[C@@H](CCc2ccccc2)C(=O)O)cc1OCc1ccccc1 |
| InChI | InChI=1S/C29H33N3O5/c1-19(2)26(30)28(34)31-23-16-14-22(17-25(23)37-18-21-11-7-4-8-12-21)27(33)32-24(29(35)36)15-13-20-9-5-3-6-10-20/h3-12,14,16-17,19,24,26H,13,15,18,30H2,1-2H3,(H,31,34)(H,32,33)(H,35,36)/t24-,26-/m0/s1 |
| InChIKey | OYUBLQMMCZPRON-AHWVRZQESA-N |
| XLogP | 4.00 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |