C20H29N3O2 — CID 166304966
2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-methyl-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]acetamide (PubChem CID 166304966) has the molecular formula C20H29N3O2 and a molecular weight of 343.47 g/mol. Its IUPAC name is 2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-methyl-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]acetamide.
| Compound Name | 2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-methyl-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 166304966 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 2-[(1S,4S)-4-aminocyclopent-2-en-1-yl]-N-methyl-N-[[4-(morpholin-4-ylmethyl)phenyl]methyl]acetamide |
| SMILES | CN(Cc1ccc(CN2CCOCC2)cc1)C(=O)C[C@H]1C=C[C@@H](N)C1 |
| InChI | InChI=1S/C20H29N3O2/c1-22(20(24)13-18-6-7-19(21)12-18)14-16-2-4-17(5-3-16)15-23-8-10-25-11-9-23/h2-7,18-19H,8-15,21H2,1H3/t18-,19+/m0/s1 |
| InChIKey | VBKTVMXQZVCVLB-RBUKOAKNSA-N |
| XLogP | 1.77 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|