About 5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonyl]-5-azaspiro[3.5]nonane-7-carboxylic acid
5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonyl]-5-azaspiro[3.5]nonane-7-carboxylic acid (PubChem CID 166306291) has the molecular formula C16H19N3O5S
and a molecular weight of 365.41 g/mol. Its IUPAC name is 5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonyl]-5-azaspiro[3.5]nonane-7-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonyl]-5-azaspiro[3.5]nonane-7-carboxylic acid |
| PubChem CID | 166306291 |
| Molecular Formula | C16H19N3O5S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonyl]-5-azaspiro[3.5]nonane-7-carboxylic acid |
| SMILES | O=C(O)C1CCC2(CCC2)N(S(=O)(=O)c2ccc3[nH]c(=O)[nH]c3c2)C1 |
| InChI | InChI=1S/C16H19N3O5S/c20-14(21)10-4-7-16(5-1-6-16)19(9-10)25(23,24)11-2-3-12-13(8-11)18-15(22)17-12/h2-3,8,10H,1,4-7,9H2,(H,20,21)(H2,17,18,22) |
| InChIKey | JBGUREWEGAQKRT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 123.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonyl]-5-azaspiro[3.5]nonane-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonyl]-5-azaspiro[3.5]nonane-7-carboxylic acid?
The IUPAC name of 5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonyl]-5-azaspiro[3.5]nonane-7-carboxylic acid (CID 166306291) is 5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonyl]-5-azaspiro[3.5]nonane-7-carboxylic acid.
What is the SMILES notation for 5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonyl]-5-azaspiro[3.5]nonane-7-carboxylic acid?
The canonical SMILES for 5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonyl]-5-azaspiro[3.5]nonane-7-carboxylic acid is O=C(O)C1CCC2(CCC2)N(S(=O)(=O)c2ccc3[nH]c(=O)[nH]c3c2)C1.
What is the InChIKey of 5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonyl]-5-azaspiro[3.5]nonane-7-carboxylic acid?
The InChIKey is JBGUREWEGAQKRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O5S/c20-14(21)10-4-7-16(5-1-6-16)19(9-10)25(23,24)11-2-3-12-13(8-11)18-15(22)17-12/h2-3,8,10H,1,4-7,9H2,(H,20,21)(H2,17,18,22).
What are the key properties of 5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonyl]-5-azaspiro[3.5]nonane-7-carboxylic acid?
5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonyl]-5-azaspiro[3.5]nonane-7-carboxylic acid has a molecular weight of 365.41 g/mol, XLogP of 1.26, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)sulfonyl]-5-azaspiro[3.5]nonane-7-carboxylic acid is sourced from PubChem (CID 166306291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).