C17H18N4O3S — CID 166306296
5-(2,2-dioxo-4,6,7,8-tetrahydropyrrolo[2,1-c][1,2,4,6]thiatriazine-3-carbonyl)-5,6,7,8-tetrahydronaphthalene-2-carbonitrile (PubChem CID 166306296) has the molecular formula C17H18N4O3S and a molecular weight of 358.42 g/mol. Its IUPAC name is 5-(2,2-dioxo-4,6,7,8-tetrahydropyrrolo[2,1-c][1,2,4,6]thiatriazine-3-carbonyl)-5,6,7,8-tetrahydronaphthalene-2-carbonitrile.
| Compound Name | 5-(2,2-dioxo-4,6,7,8-tetrahydropyrrolo[2,1-c][1,2,4,6]thiatriazine-3-carbonyl)-5,6,7,8-tetrahydronaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 166306296 |
| Molecular Formula | C17H18N4O3S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 5-(2,2-dioxo-4,6,7,8-tetrahydropyrrolo[2,1-c][1,2,4,6]thiatriazine-3-carbonyl)-5,6,7,8-tetrahydronaphthalene-2-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)CCCC2C(=O)N1CN2CCCC2=NS1(=O)=O |
| InChI | InChI=1S/C17H18N4O3S/c18-10-12-6-7-14-13(9-12)3-1-4-15(14)17(22)21-11-20-8-2-5-16(20)19-25(21,23)24/h6-7,9,15H,1-5,8,11H2 |
| InChIKey | WCNPVYSBFPXDII-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 93.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |