C19H24N4O — CID 166308946
(3aS,6aR)-N-[[5-(3-methylphenyl)-1H-imidazol-2-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide (PubChem CID 166308946) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is (3aS,6aR)-N-[[5-(3-methylphenyl)-1H-imidazol-2-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide.
| Compound Name | (3aS,6aR)-N-[[5-(3-methylphenyl)-1H-imidazol-2-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 166308946 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | (3aS,6aR)-N-[[5-(3-methylphenyl)-1H-imidazol-2-yl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxamide |
| SMILES | Cc1cccc(-c2cnc(CNC(=O)N3C[C@H]4CCC[C@H]4C3)[nH]2)c1 |
| InChI | InChI=1S/C19H24N4O/c1-13-4-2-5-14(8-13)17-9-20-18(22-17)10-21-19(24)23-11-15-6-3-7-16(15)12-23/h2,4-5,8-9,15-16H,3,6-7,10-12H2,1H3,(H,20,22)(H,21,24)/t15-,16+ |
| InChIKey | OOIZOVQMAQBXPS-IYBDPMFKSA-N |
| XLogP | 3.33 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |