C18H18F2N2O — CID 166309425
4-amino-N-[2-(2,3-dihydro-1H-inden-1-yl)ethyl]-2,5-difluorobenzamide (PubChem CID 166309425) has the molecular formula C18H18F2N2O and a molecular weight of 316.35 g/mol. Its IUPAC name is 4-amino-N-[2-(2,3-dihydro-1H-inden-1-yl)ethyl]-2,5-difluorobenzamide.
| Compound Name | 4-amino-N-[2-(2,3-dihydro-1H-inden-1-yl)ethyl]-2,5-difluorobenzamide |
|---|---|
| PubChem CID | 166309425 |
| Molecular Formula | C18H18F2N2O |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 4-amino-N-[2-(2,3-dihydro-1H-inden-1-yl)ethyl]-2,5-difluorobenzamide |
| SMILES | Nc1cc(F)c(C(=O)NCCC2CCc3ccccc32)cc1F |
| InChI | InChI=1S/C18H18F2N2O/c19-15-10-17(21)16(20)9-14(15)18(23)22-8-7-12-6-5-11-3-1-2-4-13(11)12/h1-4,9-10,12H,5-8,21H2,(H,22,23) |
| InChIKey | ZVJYNAPYGLYNIL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|