About azetidin-1-yl-[4-(1H-1,2,4-triazol-5-yl)oxan-4-yl]methanone
azetidin-1-yl-[4-(1H-1,2,4-triazol-5-yl)oxan-4-yl]methanone (PubChem CID 166310213) has the molecular formula C11H16N4O2
and a molecular weight of 236.27 g/mol. Its IUPAC name is azetidin-1-yl-[4-(1H-1,2,4-triazol-5-yl)oxan-4-yl]methanone.
Molecular Properties
| Compound Name | azetidin-1-yl-[4-(1H-1,2,4-triazol-5-yl)oxan-4-yl]methanone |
| PubChem CID | 166310213 |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | azetidin-1-yl-[4-(1H-1,2,4-triazol-5-yl)oxan-4-yl]methanone |
| SMILES | O=C(N1CCC1)C1(c2ncn[nH]2)CCOCC1 |
| InChI | InChI=1S/C11H16N4O2/c16-10(15-4-1-5-15)11(2-6-17-7-3-11)9-12-8-13-14-9/h8H,1-7H2,(H,12,13,14) |
| InChIKey | BMGWADDQNBDALF-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze azetidin-1-yl-[4-(1H-1,2,4-triazol-5-yl)oxan-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidin-1-yl-[4-(1H-1,2,4-triazol-5-yl)oxan-4-yl]methanone?
The IUPAC name of azetidin-1-yl-[4-(1H-1,2,4-triazol-5-yl)oxan-4-yl]methanone (CID 166310213) is azetidin-1-yl-[4-(1H-1,2,4-triazol-5-yl)oxan-4-yl]methanone.
What is the SMILES notation for azetidin-1-yl-[4-(1H-1,2,4-triazol-5-yl)oxan-4-yl]methanone?
The canonical SMILES for azetidin-1-yl-[4-(1H-1,2,4-triazol-5-yl)oxan-4-yl]methanone is O=C(N1CCC1)C1(c2ncn[nH]2)CCOCC1.
What is the InChIKey of azetidin-1-yl-[4-(1H-1,2,4-triazol-5-yl)oxan-4-yl]methanone?
The InChIKey is BMGWADDQNBDALF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O2/c16-10(15-4-1-5-15)11(2-6-17-7-3-11)9-12-8-13-14-9/h8H,1-7H2,(H,12,13,14).
What are the key properties of azetidin-1-yl-[4-(1H-1,2,4-triazol-5-yl)oxan-4-yl]methanone?
azetidin-1-yl-[4-(1H-1,2,4-triazol-5-yl)oxan-4-yl]methanone has a molecular weight of 236.27 g/mol, XLogP of 0.09, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azetidin-1-yl-[4-(1H-1,2,4-triazol-5-yl)oxan-4-yl]methanone is sourced from PubChem (CID 166310213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).