C14H14F3N3O4S — CID 166310751
[1,1-dioxo-6-(trifluoromethyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazin-3-yl]-[(1S,5R)-3-oxa-6-azabicyclo[3.2.0]heptan-6-yl]methanone (PubChem CID 166310751) has the molecular formula C14H14F3N3O4S and a molecular weight of 377.34 g/mol. Its IUPAC name is [1,1-dioxo-6-(trifluoromethyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazin-3-yl]-[(1S,5R)-3-oxa-6-azabicyclo[3.2.0]heptan-6-yl]methanone.
| Compound Name | [1,1-dioxo-6-(trifluoromethyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazin-3-yl]-[(1S,5R)-3-oxa-6-azabicyclo[3.2.0]heptan-6-yl]methanone |
|---|---|
| PubChem CID | 166310751 |
| Molecular Formula | C14H14F3N3O4S |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | [1,1-dioxo-6-(trifluoromethyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazin-3-yl]-[(1S,5R)-3-oxa-6-azabicyclo[3.2.0]heptan-6-yl]methanone |
| SMILES | O=C(C1Nc2cc(C(F)(F)F)ccc2S(=O)(=O)N1)N1C[C@@H]2COC[C@@H]21 |
| InChI | InChI=1S/C14H14F3N3O4S/c15-14(16,17)8-1-2-11-9(3-8)18-12(19-25(11,22)23)13(21)20-4-7-5-24-6-10(7)20/h1-3,7,10,12,18-19H,4-6H2/t7-,10+,12?/m1/s1 |
| InChIKey | VOBBTGSCEBYSKS-IOOIKYQPSA-N |
| XLogP | 0.59 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |