C18H18F3N3O6S — CID 95074134
(3S)-1,1-dioxo-6-(trifluoromethyl)-N-(3,4,5-trimethoxyphenyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-3-carboxamide (PubChem CID 95074134) has the molecular formula C18H18F3N3O6S and a molecular weight of 461.42 g/mol. Its IUPAC name is (3S)-1,1-dioxo-6-(trifluoromethyl)-N-(3,4,5-trimethoxyphenyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-3-carboxamide.
| Compound Name | (3S)-1,1-dioxo-6-(trifluoromethyl)-N-(3,4,5-trimethoxyphenyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-3-carboxamide |
|---|---|
| PubChem CID | 95074134 |
| Molecular Formula | C18H18F3N3O6S |
| Molecular Weight | 461.42 g/mol |
| Exact Mass | 461.09 |
| IUPAC Name | (3S)-1,1-dioxo-6-(trifluoromethyl)-N-(3,4,5-trimethoxyphenyl)-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-3-carboxamide |
| SMILES | COc1cc(NC(=O)[C@H]2Nc3cc(C(F)(F)F)ccc3S(=O)(=O)N2)cc(OC)c1OC |
| InChI | InChI=1S/C18H18F3N3O6S/c1-28-12-7-10(8-13(29-2)15(12)30-3)22-17(25)16-23-11-6-9(18(19,20)21)4-5-14(11)31(26,27)24-16/h4-8,16,23-24H,1-3H3,(H,22,25)/t16-/m0/s1 |
| InChIKey | KYRUIGVXIUEOKD-INIZCTEOSA-N |
| XLogP | 2.40 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |