C20H24F2N2O2 — CID 166311219
3,4-difluoro-2-[[3-[[4-(hydroxymethyl)piperidin-1-yl]methyl]anilino]methyl]phenol (PubChem CID 166311219) has the molecular formula C20H24F2N2O2 and a molecular weight of 362.42 g/mol. Its IUPAC name is 3,4-difluoro-2-[[3-[[4-(hydroxymethyl)piperidin-1-yl]methyl]anilino]methyl]phenol.
| Compound Name | 3,4-difluoro-2-[[3-[[4-(hydroxymethyl)piperidin-1-yl]methyl]anilino]methyl]phenol |
|---|---|
| PubChem CID | 166311219 |
| Molecular Formula | C20H24F2N2O2 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 3,4-difluoro-2-[[3-[[4-(hydroxymethyl)piperidin-1-yl]methyl]anilino]methyl]phenol |
| SMILES | OCC1CCN(Cc2cccc(NCc3c(O)ccc(F)c3F)c2)CC1 |
| InChI | InChI=1S/C20H24F2N2O2/c21-18-4-5-19(26)17(20(18)22)11-23-16-3-1-2-15(10-16)12-24-8-6-14(13-25)7-9-24/h1-5,10,14,23,25-26H,6-9,11-13H2 |
| InChIKey | KTLBUESFNMQVOQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|