C15H24N4O3 — CID 166311386
2-(3,4-dioxo-7,8-dihydro-6H-pyrrolo[2,1-c][1,2,4]triazin-2-yl)-N-heptylacetamide (PubChem CID 166311386) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-(3,4-dioxo-7,8-dihydro-6H-pyrrolo[2,1-c][1,2,4]triazin-2-yl)-N-heptylacetamide.
| Compound Name | 2-(3,4-dioxo-7,8-dihydro-6H-pyrrolo[2,1-c][1,2,4]triazin-2-yl)-N-heptylacetamide |
|---|---|
| PubChem CID | 166311386 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 2-(3,4-dioxo-7,8-dihydro-6H-pyrrolo[2,1-c][1,2,4]triazin-2-yl)-N-heptylacetamide |
| SMILES | CCCCCCCNC(=O)Cn1nc2n(c(=O)c1=O)CCC2 |
| InChI | InChI=1S/C15H24N4O3/c1-2-3-4-5-6-9-16-13(20)11-19-15(22)14(21)18-10-7-8-12(18)17-19/h2-11H2,1H3,(H,16,20) |
| InChIKey | HJVMOWHXQILVDT-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|