C15H18F3N5O2 — CID 166313516
1-(3-hydroxypropyl)-1-methyl-3-[1-[[4-(trifluoromethyl)phenyl]methyl]triazol-4-yl]urea (PubChem CID 166313516) has the molecular formula C15H18F3N5O2 and a molecular weight of 357.34 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-1-methyl-3-[1-[[4-(trifluoromethyl)phenyl]methyl]triazol-4-yl]urea.
| Compound Name | 1-(3-hydroxypropyl)-1-methyl-3-[1-[[4-(trifluoromethyl)phenyl]methyl]triazol-4-yl]urea |
|---|---|
| PubChem CID | 166313516 |
| Molecular Formula | C15H18F3N5O2 |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 1-(3-hydroxypropyl)-1-methyl-3-[1-[[4-(trifluoromethyl)phenyl]methyl]triazol-4-yl]urea |
| SMILES | CN(CCCO)C(=O)Nc1cn(Cc2ccc(C(F)(F)F)cc2)nn1 |
| InChI | InChI=1S/C15H18F3N5O2/c1-22(7-2-8-24)14(25)19-13-10-23(21-20-13)9-11-3-5-12(6-4-11)15(16,17)18/h3-6,10,24H,2,7-9H2,1H3,(H,19,25) |
| InChIKey | FFDOAMCWEKTBPY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |