C19H21N7O — CID 166313524
1-(4-methyl-2-phenylpiperazin-1-yl)-2-[6-(2H-tetrazol-5-yl)-3-pyridinyl]ethanone (PubChem CID 166313524) has the molecular formula C19H21N7O and a molecular weight of 363.43 g/mol. Its IUPAC name is 1-(4-methyl-2-phenylpiperazin-1-yl)-2-[6-(2H-tetrazol-5-yl)-3-pyridinyl]ethanone.
| Compound Name | 1-(4-methyl-2-phenylpiperazin-1-yl)-2-[6-(2H-tetrazol-5-yl)-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 166313524 |
| Molecular Formula | C19H21N7O |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 1-(4-methyl-2-phenylpiperazin-1-yl)-2-[6-(2H-tetrazol-5-yl)-3-pyridinyl]ethanone |
| SMILES | CN1CCN(C(=O)Cc2ccc(-c3nn[nH]n3)nc2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C19H21N7O/c1-25-9-10-26(17(13-25)15-5-3-2-4-6-15)18(27)11-14-7-8-16(20-12-14)19-21-23-24-22-19/h2-8,12,17H,9-11,13H2,1H3,(H,21,22,23,24) |
| InChIKey | MNJLGSXYYVCABT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |