C19H20N6O — CID 72863235
(4-methyl-2-phenylpiperazin-1-yl)-[2-(2H-tetrazol-5-yl)phenyl]methanone (PubChem CID 72863235) has the molecular formula C19H20N6O and a molecular weight of 348.41 g/mol. Its IUPAC name is (4-methyl-2-phenylpiperazin-1-yl)-[2-(2H-tetrazol-5-yl)phenyl]methanone.
| Compound Name | (4-methyl-2-phenylpiperazin-1-yl)-[2-(2H-tetrazol-5-yl)phenyl]methanone |
|---|---|
| PubChem CID | 72863235 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (4-methyl-2-phenylpiperazin-1-yl)-[2-(2H-tetrazol-5-yl)phenyl]methanone |
| SMILES | CN1CCN(C(=O)c2ccccc2-c2nn[nH]n2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C19H20N6O/c1-24-11-12-25(17(13-24)14-7-3-2-4-8-14)19(26)16-10-6-5-9-15(16)18-20-22-23-21-18/h2-10,17H,11-13H2,1H3,(H,20,21,22,23) |
| InChIKey | YOVNCDARBABNKU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |