C21H22N4O — CID 72920798
(4-methyl-2-phenylpiperazin-1-yl)-(5-phenyl-1H-pyrazol-4-yl)methanone (PubChem CID 72920798) has the molecular formula C21H22N4O and a molecular weight of 346.43 g/mol. Its IUPAC name is (4-methyl-2-phenylpiperazin-1-yl)-(5-phenyl-1H-pyrazol-4-yl)methanone.
| Compound Name | (4-methyl-2-phenylpiperazin-1-yl)-(5-phenyl-1H-pyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 72920798 |
| Molecular Formula | C21H22N4O |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | (4-methyl-2-phenylpiperazin-1-yl)-(5-phenyl-1H-pyrazol-4-yl)methanone |
| SMILES | CN1CCN(C(=O)c2cn[nH]c2-c2ccccc2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C21H22N4O/c1-24-12-13-25(19(15-24)16-8-4-2-5-9-16)21(26)18-14-22-23-20(18)17-10-6-3-7-11-17/h2-11,14,19H,12-13,15H2,1H3,(H,22,23) |
| InChIKey | UNBRLQWBUFADJK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |