C17H17Cl2N3O — CID 167526074
(2,6-dichloro-3-pyridinyl)-(4-methyl-2-phenylpiperazin-1-yl)methanone (PubChem CID 167526074) has the molecular formula C17H17Cl2N3O and a molecular weight of 350.25 g/mol. Its IUPAC name is (2,6-dichloro-3-pyridinyl)-(4-methyl-2-phenylpiperazin-1-yl)methanone.
| Compound Name | (2,6-dichloro-3-pyridinyl)-(4-methyl-2-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 167526074 |
| Molecular Formula | C17H17Cl2N3O |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | (2,6-dichloro-3-pyridinyl)-(4-methyl-2-phenylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2ccc(Cl)nc2Cl)C(c2ccccc2)C1 |
| InChI | InChI=1S/C17H17Cl2N3O/c1-21-9-10-22(14(11-21)12-5-3-2-4-6-12)17(23)13-7-8-15(18)20-16(13)19/h2-8,14H,9-11H2,1H3 |
| InChIKey | ZGAKYHMYANEMHB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|