C19H27N3O2 — CID 166314898
[(3aS,7aR)-7a-amino-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-(5-methyl-2-pyrrolidin-1-ylphenyl)methanone (PubChem CID 166314898) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is [(3aS,7aR)-7a-amino-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-(5-methyl-2-pyrrolidin-1-ylphenyl)methanone.
| Compound Name | [(3aS,7aR)-7a-amino-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-(5-methyl-2-pyrrolidin-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 166314898 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | [(3aS,7aR)-7a-amino-1,3,3a,4,6,7-hexahydropyrano[3,4-c]pyrrol-2-yl]-(5-methyl-2-pyrrolidin-1-ylphenyl)methanone |
| SMILES | Cc1ccc(N2CCCC2)c(C(=O)N2C[C@@H]3COCC[C@]3(N)C2)c1 |
| InChI | InChI=1S/C19H27N3O2/c1-14-4-5-17(21-7-2-3-8-21)16(10-14)18(23)22-11-15-12-24-9-6-19(15,20)13-22/h4-5,10,15H,2-3,6-9,11-13,20H2,1H3/t15-,19+/m1/s1 |
| InChIKey | YHHUJMKNJMPGHX-BEFAXECRSA-N |
| XLogP | 1.79 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |