C19H26N2O2 — CID 166316469
(E)-N-[(4-cyanophenyl)methyl]-2-ethyl-N-(2-methoxyethyl)hex-4-enamide (PubChem CID 166316469) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is (E)-N-[(4-cyanophenyl)methyl]-2-ethyl-N-(2-methoxyethyl)hex-4-enamide.
| Compound Name | (E)-N-[(4-cyanophenyl)methyl]-2-ethyl-N-(2-methoxyethyl)hex-4-enamide |
|---|---|
| PubChem CID | 166316469 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | (E)-N-[(4-cyanophenyl)methyl]-2-ethyl-N-(2-methoxyethyl)hex-4-enamide |
| SMILES | C/C=C/CC(CC)C(=O)N(CCOC)Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H26N2O2/c1-4-6-7-18(5-2)19(22)21(12-13-23-3)15-17-10-8-16(14-20)9-11-17/h4,6,8-11,18H,5,7,12-13,15H2,1-3H3/b6-4+ |
| InChIKey | XOSYUQHOPGYBEV-GQCTYLIASA-N |
| XLogP | 3.53 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|