C20H15N7 — CID 166319969
N-[4-(pyridin-4-ylmethyl)phenyl]tetrazolo[1,5-a]quinoxalin-4-amine (PubChem CID 166319969) has the molecular formula C20H15N7 and a molecular weight of 353.39 g/mol. Its IUPAC name is N-[4-(pyridin-4-ylmethyl)phenyl]tetrazolo[1,5-a]quinoxalin-4-amine.
| Compound Name | N-[4-(pyridin-4-ylmethyl)phenyl]tetrazolo[1,5-a]quinoxalin-4-amine |
|---|---|
| PubChem CID | 166319969 |
| Molecular Formula | C20H15N7 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-[4-(pyridin-4-ylmethyl)phenyl]tetrazolo[1,5-a]quinoxalin-4-amine |
| SMILES | c1ccc2c(c1)nc(Nc1ccc(Cc3ccncc3)cc1)c1nnnn12 |
| InChI | InChI=1S/C20H15N7/c1-2-4-18-17(3-1)23-19(20-24-25-26-27(18)20)22-16-7-5-14(6-8-16)13-15-9-11-21-12-10-15/h1-12H,13H2,(H,22,23) |
| InChIKey | AKBHEIQXEOXRLH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |