C15H19N2OP — CID 166321015
4-dimethylphosphoryl-N-[(3-methylphenyl)methyl]pyridin-2-amine (PubChem CID 166321015) has the molecular formula C15H19N2OP and a molecular weight of 274.30 g/mol. Its IUPAC name is 4-dimethylphosphoryl-N-[(3-methylphenyl)methyl]pyridin-2-amine.
| Compound Name | 4-dimethylphosphoryl-N-[(3-methylphenyl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 166321015 |
| Molecular Formula | C15H19N2OP |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 4-dimethylphosphoryl-N-[(3-methylphenyl)methyl]pyridin-2-amine |
| SMILES | Cc1cccc(CNc2cc(P(C)(C)=O)ccn2)c1 |
| InChI | InChI=1S/C15H19N2OP/c1-12-5-4-6-13(9-12)11-17-15-10-14(7-8-16-15)19(2,3)18/h4-10H,11H2,1-3H3,(H,16,17) |
| InChIKey | XQPMSXVCAHSRRO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|